For research use only. Not for therapeutic Use.
KB3022(CAT: I013336) is a cyclooxygenase (COX) inhibitor. COX inhibitors are a class of drugs that block the activity of the enzymes cyclooxygenase-1 (COX-1) and cyclooxygenase-2 (COX-2), which are involved in the synthesis of inflammatory mediators called prostaglandins. By inhibiting COX enzymes, these drugs can help reduce inflammation, pain, and fever.
| Catalog Number | I013336 |
| CAS Number | 101001-34-7 |
| Molecular Formula | C₂₅H₂₄N₂O₄S |
| Purity | ≥95% |
| Target | COX |
| Solubility | DMSO |
| IUPAC Name | ethyl 2-[2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]pyrrol-1-yl]acetate |
| InChI | InChI=1S/C25H24N2O4S/c1-4-31-22(28)16-27-15-5-6-21(27)25-26-23(17-7-11-19(29-2)12-8-17)24(32-25)18-9-13-20(30-3)14-10-18/h5-15H,4,16H2,1-3H3 |
| InChIKey | ISCHOARKJADAKJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C=CC=C1C2=NC(=C(S2)C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC |
| Reference | [1]. Light P. Pamicogrel (Kanebo). IDrugs. 1999 Sep;2(9):938-42. |
