For research use only. Not for therapeutic Use.
KC7F2(cat: I005516) is a compound known for its inhibitory effects on the hypoxia-inducible factor-1 (HIF-1) pathway. HIF-1 is a transcription factor that plays a crucial role in cellular responses to hypoxia (low oxygen levels) and is implicated in various aspects of cancer progression and metastasis. KC7F2 has demonstrated potent inhibitory activity against the HIF-1 pathway, potentially interfering with the activation of genes involved in tumor growth and angiogenesis.
CAS Number | 927822-86-4 |
Synonyms | 2,5-dichloro-N-[2-[2-[(2,5-dichlorophenyl)sulfonylamino]ethyldisulfanyl]ethyl]benzenesulfonamide |
Molecular Formula | C₁₆H₁₆Cl₄N₂O₄S₄ |
Purity | ≥95% |
Target | HIF/HIF Prolyl-Hydroxylase |
Solubility | DMSO: ≥ 32 mg/mL |
Storage | Store at -20°C |
InChI | InChI=1S/C16H16Cl4N2O4S4/c17-11-1-3-13(19)15(9-11)29(23,24)21-5-7-27-28-8-6-22-30(25,26)16-10-12(18)2-4-14(16)20/h1-4,9-10,21-22H,5-8H2 |
InChIKey | REQLACDIZMLXIC-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1Cl)S(=O)(=O)NCCSSCCNS(=O)(=O)C2=C(C=CC(=C2)Cl)Cl)Cl |
Reference | <p> |