For research use only. Not for therapeutic Use.
KCNQ1 activator-1（Cat No.:I043699）is a small molecule designed to selectively activate the KCNQ1 potassium channel, which plays a crucial role in regulating cardiac action potentials and smooth muscle function. By enhancing KCNQ1 activity, this compound helps to improve cellular ion flow, potentially benefiting conditions related to heart rhythm disorders, such as Long QT syndrome. KCNQ1 activator-1 has shown promise in preclinical studies for its ability to restore normal channel function, making it a valuable tool for exploring new therapeutic approaches to cardiac arrhythmias and other ion channel-related diseases.
| CAS Number | 1008671-38-2 |
| Synonyms | 1-(benzenesulfonyl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]piperidine-2-carboxamide |
| Molecular Formula | C22H23N3O4S2 |
| Purity | ≥95% |
| IUPAC Name | 1-(benzenesulfonyl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]piperidine-2-carboxamide |
| InChI | InChI=1S/C22H23N3O4S2/c1-29-17-12-10-16(11-13-17)19-15-30-22(23-19)24-21(26)20-9-5-6-14-25(20)31(27,28)18-7-3-2-4-8-18/h2-4,7-8,10-13,15,20H,5-6,9,14H2,1H3,(H,23,24,26) |
| InChIKey | UUTYPVHYRISWDI-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CSC(=N2)NC(=O)C3CCCCN3S(=O)(=O)C4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
