For research use only. Not for therapeutic Use.
KDM5-C70 is a selective inhibitor of the KDM5 family of histone demethylases, enzymes involved in epigenetic regulation by removing methyl groups from lysine residues on histone proteins. By inhibiting KDM5, KDM5-C70 influences gene expression, making it a valuable tool in cancer research where dysregulated epigenetic processes often play a role. The compound has shown potential in targeting cancer cells, particularly in overcoming drug resistance mechanisms in certain cancers. KDM5-C70 is being explored for its therapeutic potential in epigenetic therapies aimed at restoring normal gene regulation in cancerous cells.
| Catalog Number | I007490 |
| CAS Number | 1596348-32-1 |
| Synonyms | KDM5-C70; KDM5C70; KDM5 C70.;ethyl 2-(((2-((2-(dimethylamino)ethyl)(ethyl)amino)-2-oxoethyl)amino)methyl)isonicotinate |
| Molecular Formula | C17H28N4O3 |
| Purity | ≥95% |
| Target | Histone Demethylase |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4°C for short term , or -20°C for long term. |
| IUPAC Name | ethyl 2-[[[2-[2-(dimethylamino)ethyl-ethylamino]-2-oxoethyl]amino]methyl]pyridine-4-carboxylate |
| InChI | InChI=1S/C17H28N4O3/c1-5-21(10-9-20(3)4)16(22)13-18-12-15-11-14(7-8-19-15)17(23)24-6-2/h7-8,11,18H,5-6,9-10,12-13H2,1-4H3 |
| InChIKey | WCILOMUUNVPIKQ-UHFFFAOYSA-N |
| SMILES | CCN(CCN(C)C)C(=O)CNCC1=NC=CC(=C1)C(=O)OCC |
