For research use only. Not for therapeutic Use.
Ketanserin（Cat No.:A000830）is a selective serotonin 5-HT2A receptor antagonist primarily used to manage hypertension and related cardiovascular conditions. By blocking 5-HT2A receptors, Ketanserin reduces the vasoconstrictive effects of serotonin, leading to vasodilation and lower blood pressure. It also exhibits alpha-1 adrenergic blocking properties, further contributing to its antihypertensive effects. Beyond cardiovascular use, Ketanserin has been studied for its potential to treat conditions such as platelet aggregation disorders and glaucoma. Its dual action on serotonin and adrenergic receptors makes it a versatile agent in vascular health management.
| Catalog Number | A000830 |
| CAS Number | 74050-98-9 |
| Synonyms | R41468 |
| Molecular Formula | C22H22FN3O3 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Limited solubility |
| Storage | 3 years -20C powder |
| IUPAC Name | 3-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-1H-quinazoline-2,4-dione |
| InChI | InChI=1S/C22H22FN3O3/c23-17-7-5-15(6-8-17)20(27)16-9-11-25(12-10-16)13-14-26-21(28)18-3-1-2-4-19(18)24-22(26)29/h1-8,16H,9-14H2,(H,24,29) |
| InChIKey | FPCCSQOGAWCVBH-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)C2=CC=C(C=C2)F)CCN3C(=O)C4=CC=CC=C4NC3=O |
