For research use only, not for therapeutic use.
Ketanserin Tartrate（Cat No.:I005020）is a selective serotonin 5-HT2A receptor antagonist primarily used to manage hypertension and certain vascular conditions. By blocking 5-HT2A receptors, it reduces serotonin-induced vasoconstriction, thereby lowering blood pressure and improving blood flow. Ketanserin Tartrate also exhibits antagonistic activity on alpha-1 adrenergic receptors, contributing to its vasodilatory effects. It has been explored in research related to thrombosis, vasospasm, and other cardiovascular disorders. Additionally, its role in modulating serotonin pathways has made it a valuable tool in studying psychiatric and neurological conditions involving serotonin dysregulation.
| Catalog Number | I005020 |
| CAS Number | 83846-83-7 |
| Synonyms | R 49945 |
| Molecular Formula | C22H22FN3O3 • C4H6O6 |
| Purity | ≥95% |
| Target | 0.11 μM (hERG current)[1] |
| Solubility | H2O: ≤ 30 mg/mL (Need ultrasonic and warming) |
| Storage | 2-8°C |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;3-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-1H-quinazoline-2,4-dione |
| InChI | InChI=1S/C22H22FN3O3.C4H6O6/c23-17-7-5-15(6-8-17)20(27)16-9-11-25(12-10-16)13-14-26-21(28)18-3-1-2-4-19(18)24-22(26)29;5-1(3(7)8)2(6)4(9)10/h1-8,16H,9-14H2,(H,24,29);1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | KMTLTEVOQLMYRS-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)C2=CC=C(C=C2)F)CCN3C(=O)C4=CC=CC=C4NC3=O.C(C(C(=O)O)O)(C(=O)O)O |
| Reference | <p style=/line-height:25px/> |
