For research use only. Not for therapeutic Use.
Ketoprofen-d4(Cat No.:S000330) is a deuterated version of ketoprofen, where four hydrogen atoms are replaced with deuterium. Ketoprofen is a nonsteroidal anti-inflammatory drug (NSAID) used to treat pain and inflammation associated with arthritis, injuries, and other conditions. The inclusion of deuterium enhances the molecular stability of ketoprofen, allowing for more detailed pharmacokinetic and metabolic studies. These studies are crucial for understanding how ketoprofen is metabolized and cleared from the body, which can lead to better management of dosages and timing, thus improving its effectiveness and reducing potential side effects for patients.
CAS Number | 1219805-29-4 |
Molecular Formula | C16H10D4O3 |
Purity | ≥95% |
Target | Apoptosis |
IUPAC Name | 2-(3-benzoylphenyl)-2,3,3,3-tetradeuteriopropanoic acid |
InChI | InChI=1S/C16H14O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-11H,1H3,(H,18,19)/i1D3,11D |
InChIKey | DKYWVDODHFEZIM-RRRGEQHMSA-N |
SMILES | CC(C1=CC(=CC=C1)C(=O)C2=CC=CC=C2)C(=O)O |