For research use only. Not for therapeutic Use.
Ketorolac-d5 is a deuterated nonsteroidal anti-inflammatory drug (NSAID) essential for advanced pharmaceutical research. This isotopically labeled version, featuring five deuterium atoms, is crucial for studying pharmacokinetics, metabolic pathways, and drug interactions. It offers enhanced stability and precise analytical results due to its stable isotope labeling. Ideal for clinical research and drug development, Ketorolac-d5 integrates seamlessly into existing protocols, providing a robust and cost-effective solution for high-precision scientific investigations. Enhance your research accuracy and reliability with Ketorolac-d5.
| Catalog Number | R044216 |
| CAS Number | 1215767-66-0 |
| Synonyms | (±)-5-Benzoyl-d5-2,3-dihydro-1H-pyrrolizine-1-carboxylic Acid; (±)-Ketorolac-d5; Acular LS-d5; Keromin-d5; RS 37619-d5; Sprix-d5 |
| Molecular Formula | C15H13NO3 |
| Purity | ≥95% |
| Target | COX |
| Storage | -20°C |
| Related CAS | 74103-06-3 (unlabeled) |
| IUPAC Name | 5-(2,3,4,5,6-pentadeuteriobenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid |
| InChI | InChI=1S/C15H13NO3/c17-14(10-4-2-1-3-5-10)13-7-6-12-11(15(18)19)8-9-16(12)13/h1-7,11H,8-9H2,(H,18,19)/i1D,2D,3D,4D,5D |
| InChIKey | OZWKMVRBQXNZKK-RALIUCGRSA-N |
| SMILES | C1CN2C(=CC=C2C(=O)C3=CC=CC=C3)C1C(=O)O |
