For research use only. Not for therapeutic Use.
KGP94（Cat No.:I007498）is an investigational small molecule that acts as a selective inhibitor of the 26S proteasome, a key component of the ubiquitin-proteasome system responsible for degrading unwanted or damaged proteins within cells. By inhibiting the proteasome, KGP94 disrupts protein turnover, which can lead to the accumulation of misfolded or damaged proteins, potentially inducing cell death in cancer cells. This compound is being studied for its potential as a cancer therapeutic, particularly in tumors that rely on the proteasome for survival, and could offer a novel approach to treating various cancers resistant to conventional therapies.
| CAS Number | 1131456-28-4 |
| Synonyms | [(Z)-[(3-bromophenyl)-(3-hydroxyphenyl)methylidene]amino]thiourea |
| Molecular Formula | C14H12BrN3OS |
| Purity | ≥95% |
| IUPAC Name | [(Z)-[(3-bromophenyl)-(3-hydroxyphenyl)methylidene]amino]thiourea |
| InChI | InChI=1S/C14H12BrN3OS/c15-11-5-1-3-9(7-11)13(17-18-14(16)20)10-4-2-6-12(19)8-10/h1-8,19H,(H3,16,18,20)/b17-13+ |
| InChIKey | ZDBKSZKTCPOBFR-GHRIWEEISA-N |
| SMILES | C1=CC(=CC(=C1)O)/C(=N/NC(=S)N)/C2=CC(=CC=C2)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
