For research use only. Not for therapeutic Use.
Kif15-IN-1(Cat No.:I004527)is a small molecule inhibitor targeting Kif15, a kinesin motor protein involved in spindle assembly during cell division. Kif15 plays a key role in the mitotic process, particularly in maintaining proper chromosome alignment and segregation. By inhibiting Kif15, Kif15-IN-1 disrupts mitosis, leading to cell cycle arrest and potential tumor cell death. This makes it a promising candidate for cancer therapy, especially in tumors where Kif15 is overexpressed. Preclinical studies aim to assess its potency, selectivity, and therapeutic potential in combating malignancies by targeting cell division processes.
CAS Number | 672926-32-8 |
Synonyms | (S,Z)-N-(5-(ethoxycarbonyl)-4-methylthiazol-2-yl)-2-(2-hydroxy-4-oxoquinazolin-3(4H)-yl)-3-methylbutanimidic acid |
Molecular Formula | C20H22N4O5S |
Purity | ≥95% |
Target | Cytoskeleton |
Solubility | 10 mM in DMSO |
Storage | Store at +4C |
IUPAC Name | ethyl 2-[[(2S)-2-(2,4-dioxo-1H-quinazolin-3-yl)-3-methylbutanoyl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
InChI | InChI=1S/C20H22N4O5S/c1-5-29-18(27)15-11(4)21-19(30-15)23-16(25)14(10(2)3)24-17(26)12-8-6-7-9-13(12)22-20(24)28/h6-10,14H,5H2,1-4H3,(H,22,28)(H,21,23,25)/t14-/m0/s1 |
InChIKey | CTQQKICGMSZCJL-AWEZNQCLSA-N |
SMILES | CCOC(=O)C1=C(N=C(S1)NC(=O)[C@H](C(C)C)N2C(=O)C3=CC=CC=C3NC2=O)C |
Reference | <p style=/line-height:25px/> </p> |