For research use only. Not for therapeutic Use.
KIF18A-IN-7（Cat No.:I041405）is a small molecule inhibitor that targets KIF18A, a kinesin motor protein involved in the regulation of mitotic spindle assembly and chromosome alignment during cell division. By inhibiting KIF18A, KIF18A-IN-7 disrupts proper mitotic progression, leading to mitotic arrest and subsequent cell death. This mechanism makes it a potential therapeutic candidate for cancer treatment, as many cancer cells rely on rapid and uncontrolled cell division. Research into KIF18A-IN-7 is ongoing to evaluate its efficacy in targeting cancer cells and its potential for use in combination with other anti-cancer therapies.
| CAS Number | 2914878-00-3 |
| Molecular Formula | C27H35N3O5S2 |
| Purity | ≥95% |
| InChI | InChI=1S/C27H35N3O5S2/c1-25(2,3)29-37(34,35)21-7-5-6-19(16-21)24(31)30-18-27(14-12-26(10-11-26)13-15-27)22-17-20(8-9-23(22)30)28-36(4,32)33/h5-9,16-17,28-29H,10-15,18H2,1-4H3 |
| InChIKey | CPAWWZCHEMFYGG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)C1=CC=CC(=C1)C(=O)N2CC3(CCC4(CC4)CC3)C5=C2C=CC(=C5)NS(=O)(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
