For research use only. Not for therapeutic Use.
KIN1148（Cat No.:I013398）is a selective small-molecule inhibitor targeting c-Met, a receptor tyrosine kinase involved in cellular processes like growth, motility, and survival. Overexpression and dysregulation of c-Met are associated with cancer progression and metastasis, making KIN1148 a promising agent in oncology research. By blocking c-Met signaling, KIN1148 disrupts cancer cell proliferation and invasive capabilities, providing potential therapeutic benefits in treating c-Met-dependent tumors. Its selectivity and efficacy in inhibiting this pathway make KIN1148 valuable for investigating targeted cancer therapies and understanding mechanisms of tumor progression.
| Catalog Number | I013398 |
| CAS Number | 1428729-56-9 |
| Molecular Formula | C₁₉H₁₁N₃OS₂ |
| Purity | ≥95% |
| Target | Influenza Virus |
| Solubility | DMSO: ≥100 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | N-([1,3]thiazolo[5,4-e][1,3]benzothiazol-2-yl)naphthalene-2-carboxamide |
| InChI | InChI=1S/C19H11N3OS2/c23-18(13-6-5-11-3-1-2-4-12(11)9-13)22-19-21-14-7-8-15-16(17(14)25-19)20-10-24-15/h1-10H,(H,21,22,23) |
| InChIKey | YAISOECYKYATLL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)NC3=NC4=C(S3)C5=C(C=C4)SC=N5 |
| Reference | [1]. Probst P, et al. A small-molecule IRF3 agonist functions as an influenza vaccine adjuvant by modulating the antiviral immune response. Vaccine. 2017 Apr 4;35(15):1964-1971. |
