For research use only. Not for therapeutic Use.
Kinsenoside（Cat No.:R072577） is the predominant active compound derived from plants of the Calendula genus, exhibiting diverse biological activities and pharmacological effects. It plays a protective role in nucleus pulposus cells (NPCs) subjected to oxidative stress by activating the Nrf2 pathway. Through this mechanism, it prevents apoptosis, senescence, and mitochondrial dysfunction in NPCs. Kinsenoside’s Nrf2-dependent action demonstrates its potential as a therapeutic agent for conditions involving oxidative stress-induced damage and highlights its significance in maintaining the viability and function of nucleus pulposus cells.
| Catalog Number | R072577 |
| CAS Number | 151870-74-5 |
| Molecular Formula | C10H16O8 |
| Purity | ≥95% |
| Storage | 4°C, protect from light |
| IUPAC Name | (4R)-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-one |
| InChI | InChI=1S/C10H16O8/c11-2-5-7(13)8(14)9(15)10(18-5)17-4-1-6(12)16-3-4/h4-5,7-11,13-15H,1-3H2/t4-,5-,7-,8+,9-,10-/m1/s1 |
| InChIKey | MQEPWBMWFIVRPS-ZGSHZZHUSA-N |
| SMILES | C1C(COC1=O)OC2C(C(C(C(O2)CO)O)O)O |
