For research use only. Not for therapeutic Use.
KKII5(Cat No.:I041246)is a synthetic peptide used in biochemical and pharmacological research. It consists of a specific amino acid sequence designed to interact with proteins or receptors involved in cellular signaling pathways. Peptides like KKII5 are commonly employed to study protein-protein interactions, enzyme activity, or receptor binding in various cellular processes. Researchers explore its potential applications in drug development, cancer research, and immunology, as it may help elucidate the mechanisms underlying disease progression or provide insight into new therapeutic targets. The compound is useful for both in vitro and in vivo experiments.
CAS Number | 6381-55-1 |
Synonyms | 4,6-diphenyl-3,4-dihydro-1H-pyrimidine-2-thione |
Molecular Formula | C16H14N2S |
Purity | ≥95% |
IUPAC Name | 4,6-diphenyl-3,4-dihydro-1H-pyrimidine-2-thione |
InChI | InChI=1S/C16H14N2S/c19-16-17-14(12-7-3-1-4-8-12)11-15(18-16)13-9-5-2-6-10-13/h1-11,14H,(H2,17,18,19) |
InChIKey | HFRXOUDZIXBXEH-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2C=C(NC(=S)N2)C3=CC=CC=C3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |