For research use only. Not for therapeutic Use.
KKL-35（Cat No.:I012530）is a small-molecule inhibitor with promising antibacterial activity, particularly against Mycobacterium tuberculosis. It targets the ClpP protease system, a crucial component in bacterial protein degradation and quality control. By inhibiting ClpP, KKL-35 disrupts essential protein turnover, leading to cellular stress and bacterial death. This compound is valuable in research for developing novel treatments against tuberculosis and other bacterial infections, especially in drug-resistant strains. KKL-35’s specific mechanism and efficacy make it an important tool in exploring new antibacterial pathways and combating persistent infections.
| Catalog Number | I012530 |
| CAS Number | 865285-29-6 |
| Synonyms | 4-Chloro-N-[5-(4-fluoro-phenyl)-[1,3,4]oxadiazol-2-yl]-benzamide |
| Molecular Formula | C15H9ClFN3O2 |
| Purity | ≥95% |
| Storage | 2-8°C |
| IUPAC Name | 4-chloro-N-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]benzamide |
| InChI | InChI=1S/C15H9ClFN3O2/c16-11-5-1-9(2-6-11)13(21)18-15-20-19-14(22-15)10-3-7-12(17)8-4-10/h1-8H,(H,18,20,21) |
| InChIKey | ZIICPNCCHIUJSX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)NC(=O)C3=CC=C(C=C3)Cl)F |
