For research use only. Not for therapeutic Use.
(2S,4S)-Methyl 4-hydroxypyrrolidine-2-carboxylate hydrochloride(CAT: R073102) is of interest in organic synthesis and pharmaceutical research, particularly in the preparation of chiral building blocks and peptide-based pharmaceuticals. The presence of the hydroxyl and carboxyl groups makes it a valuable intermediate for the synthesis of complex molecules. Researchers use it in the preparation of potential drug candidates and in medicinal chemistry studies.
Catalog Number | R073102 |
CAS Number | 40126-30-5 |
Molecular Formula | C6H12ClNO3 |
Purity | ≥95% |
Target | PROTAC |
IUPAC Name | methyl (2S,4S)-4-hydroxypyrrolidine-2-carboxylate;hydrochloride |
InChI | InChI=1S/C6H11NO3.ClH/c1-10-6(9)5-2-4(8)3-7-5;/h4-5,7-8H,2-3H2,1H3;1H/t4-,5-;/m0./s1 |
InChIKey | KLGSHNXEUZOKHH-FHAQVOQBSA-N |
SMILES | COC(=O)C1CC(CN1)O.Cl |