For research use only. Not for therapeutic Use.
KMUP-3(CAT: I030114) is a multifunctional compound known for enhancing cyclic guanosine monophosphate (cGMP) activity and acting as a potent aortic smooth muscle relaxant. By increasing cGMP levels, KMUP-3 promotes vasodilation and improves vascular function, leading to the relaxation of vascular smooth muscle cells. This mechanism makes KMUP-3 a promising candidate for treating cardiovascular diseases, such as hypertension, pulmonary hypertension, and atherosclerosis. Additionally, its ability to modulate vascular tone and reduce vascular resistance highlights its potential in vascular biology research and the development of therapies for vascular dysfunction and vascular-related disorders.
CAS Number | 421556-16-3 |
Synonyms | KMUP-3; KMUP 3; KMUP3; |
Molecular Formula | C19H23N7O4 |
Purity | 98% |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | 1,3-dimethyl-7-(2-(4-(4-nitrophenyl)piperazin-1-yl)ethyl)-3,7-dihydro-1H-purine-2,6-dione |
InChI | InChI=1S/C19H23N7O4/c1-21-17-16(18(27)22(2)19(21)28)25(13-20-17)12-9-23-7-10-24(11-8-23)14-3-5-15(6-4-14)26(29)30/h3-6,13H,7-12H2,1-2H3 |
InChIKey | WUNWRZDRKZFAHV-UHFFFAOYSA-N |
SMILES | CN1C(N(C)C(N=CN2CCN3CCN(C4=CC=C([N+]([O-])=O)C=C4)CC3)=C2C1=O)=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |