For research use only. Not for therapeutic Use.
Ko-3290(Cat No.:I013582)is a small molecule inhibitor developed to target and inhibit specific enzymes involved in cellular signaling pathways, particularly those related to cancer and inflammation. It has shown potential in preclinical studies as an anti-cancer agent, possibly by affecting mechanisms that drive tumor cell growth, survival, and metastasis. The compound has also been investigated for its role in modulating immune responses and reducing inflammation. Research on Ko-3290 is still in the early stages, with ongoing studies aimed at evaluating its safety, efficacy, and potential therapeutic applications for various cancers and inflammatory diseases.
CAS Number | 79848-61-6 |
Molecular Formula | C₁₉H₂₅N₃O₃ |
Purity | ≥95% |
Target | Neuronal Signaling |
Solubility | DMSO |
IUPAC Name | N-[3-cyano-4-[2-hydroxy-3-(2-methylbut-3-yn-2-ylamino)propoxy]phenyl]-2-methylpropanamide |
InChI | InChI=1S/C19H25N3O3/c1-6-19(4,5)21-11-16(23)12-25-17-8-7-15(9-14(17)10-20)22-18(24)13(2)3/h1,7-9,13,16,21,23H,11-12H2,2-5H3,(H,22,24) |
InChIKey | OPEGAEBRVGIBAS-UHFFFAOYSA-N |
SMILES | CC(C)C(=O)NC1=CC(=C(C=C1)OCC(CNC(C)(C)C#C)O)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |