For research use only. Not for therapeutic Use.
KPT-251（Cat No.:I030143）is a selective inhibitor of nuclear export (SINE) compound, designed to target the nuclear export protein XPO1 (exportin 1). By inhibiting XPO1, KPT-251 disrupts the export of tumor suppressor proteins and other key regulatory proteins from the nucleus, leading to the accumulation of these proteins within the nucleus and inducing cancer cell apoptosis. This mechanism makes KPT-251 a promising candidate for the treatment of various cancers, particularly hematologic malignancies. It is currently under investigation in preclinical studies, showing potential as a novel anticancer therapeutic.
| Catalog Number | I030143 |
| CAS Number | 1388841-50-6 |
| Synonyms | 2-[(Z)-2-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]ethenyl]-1,3,4-oxadiazole |
| Molecular Formula | C14H7F6N5O |
| Purity | ≥95% |
| IUPAC Name | 2-[(Z)-2-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]ethenyl]-1,3,4-oxadiazole |
| InChI | InChI=1S/C14H7F6N5O/c15-13(16,17)9-3-8(4-10(5-9)14(18,19)20)12-21-6-25(24-12)2-1-11-23-22-7-26-11/h1-7H/b2-1- |
| InChIKey | LDFXTRYMMZGKIC-UPHRSURJSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C2=NN(C=N2)C=CC3=NN=CO3 |
