For research use only. Not for therapeutic Use.
KR-32568(Cat No.:I042332)is a small molecule compound being investigated for its potential therapeutic applications, particularly in oncology and immune modulation. It is known for its ability to target specific enzymes or receptors involved in cancer cell proliferation, immune response regulation, or tumor microenvironment modulation. Research suggests KR-32568 could have a role in enhancing the body’s immune system to fight cancer or other diseases by blocking pathways critical to tumor growth. However, clinical studies are still in early stages, and further research is required to fully understand its efficacy, safety, and therapeutic potential.
CAS Number | 852146-73-7 |
Synonyms | N-(diaminomethylidene)-5-(5-fluoro-2-methylphenyl)furan-2-carboxamide |
Molecular Formula | C13H12FN3O2 |
Purity | ≥95% |
IUPAC Name | N-(diaminomethylidene)-5-(5-fluoro-2-methylphenyl)furan-2-carboxamide |
InChI | InChI=1S/C13H12FN3O2/c1-7-2-3-8(14)6-9(7)10-4-5-11(19-10)12(18)17-13(15)16/h2-6H,1H3,(H4,15,16,17,18) |
InChIKey | DTLDHYBZLVASJQ-UHFFFAOYSA-N |
SMILES | CC1=C(C=C(C=C1)F)C2=CC=C(O2)C(=O)N=C(N)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |