For research use only. Not for therapeutic Use.
KRN7000(Cat No.:I000024), also known as alpha-GalCer, is a synthetic glycolipid that activates invariant natural killer T (iNKT) cells, playing a crucial role in immunological research. It binds to CD1d molecules on antigen-presenting cells, leading to the rapid release of cytokines and modulation of immune responses. KRN7000 has shown promise in cancer immunotherapy, infectious diseases, and autoimmune conditions by enhancing the body’s immune defense mechanisms. Its ability to induce both Th1 and Th2 responses makes it a versatile tool for studying immune regulation and developing novel therapeutic strategies.
CAS Number | 158021-47-7 |
Synonyms | a-Galactosylceramide; N-[(1S,2S,3R)-1-[(α-D-Galactopyranosyloxy)methyl]-2,3-dihydroxyheptadecyl]hexacosanamide; |
Molecular Formula | C50H99NO9 |
Purity | ≥95% |
Solubility | Insoluble in water, methanol, ethanol or other organic solvents, very slightly soluble in tetrahydrofuran, slightly soluble in pyridine |
Storage | -20°C |
IUPAC Name | N-[(2S,3S,4R)-3,4-dihydroxy-1-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctadecan-2-yl]hexacosanamide |
InChI | InChI=1S/C50H99NO9/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-23-24-25-26-27-29-31-33-35-37-39-45(54)51-42(41-59-50-49(58)48(57)47(56)44(40-52)60-50)46(55)43(53)38-36-34-32-30-28-16-14-12-10-8-6-4-2/h42-44,46-50,52-53,55-58H,3-41H2,1-2H3,(H,51,54)/t42-,43+,44+,46-,47-,48-,49+,50-/m0/s1 |
InChIKey | VQFKFAKEUMHBLV-BYSUZVQFSA-N |
SMILES | CCCCCCCCCCCCCCCCCCCCCCCCCC(=O)NC(COC1C(C(C(C(O1)CO)O)O)O)C(C(CCCCCCCCCCCCCC)O)O |