For research use only. Not for therapeutic Use.
KS-176 (CAT: I001008) is a potent and selective inhibitor of the breast cancer resistance protein (BCRP), which is a multidrug transporter involved in drug efflux from cells. BCRP plays a crucial role in drug resistance by pumping various anticancer drugs out of cancer cells, leading to reduced effectiveness of chemotherapy. KS-176’s inhibitory action on BCRP can potentially enhance the intracellular concentration of chemotherapeutic agents, thereby overcoming drug resistance and improving the therapeutic outcomes of anticancer treatments.
| Catalog Number | I001008 |
| CAS Number | 1253452-78-6 |
| Synonyms | N-(4-(2-hydroxyethyl)phenyl)-2-(4-nitrobenzamido)benzamide |
| Molecular Formula | C₂₂H₁₉N₃O₅ |
| Purity | ≥95% |
| Target | BCRP |
| Solubility | DMSO: ≥ 35 mg/mL |
| Storage | Store at +4C |
| IC50 | 0.59( in Pheo A assay), 1.39 μM (in Hoechst 33342 assay). |
| InChI | InChI=1S/C22H19N3O5/c26-14-13-15-5-9-17(10-6-15)23-22(28)19-3-1-2-4-20(19)24-21(27)16-7-11-18(12-8-16)25(29)30/h1-12,26H,13-14H2,(H,23,28)(H,24,27) |
| InChIKey | LTWQQWSXYYXVGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC=C(C=C2)CCO)NC(=O)C3=CC=C(C=C3)[N+](=O)[O-] |
| Reference | <p style=/line-height:25px/> </p> |
