For research use only. Not for therapeutic Use.
KS370G（Cat No.:M137062）is a potent and selective inhibitor of glycogen synthase kinase-3 beta (GSK-3β), an enzyme involved in regulating a wide array of cellular processes, including metabolism, gene expression, and neurogenesis. By inhibiting GSK-3β, KS370G is being studied for its potential to treat diseases such as Alzheimer’s, Parkinson’s, and other neurodegenerative conditions, where GSK-3β activity contributes to disease progression. Additionally, it may have applications in cancer and diabetes research. Ongoing studies aim to better understand its pharmacological profile and evaluate its therapeutic potential in various disease models.
| CAS Number | 105955-01-9 |
| Synonyms | (E)-3-(3,4-dihydroxyphenyl)-N-(2-phenylethyl)prop-2-enamide |
| Molecular Formula | C17H17NO3 |
| Purity | ≥95% |
| IUPAC Name | (E)-3-(3,4-dihydroxyphenyl)-N-(2-phenylethyl)prop-2-enamide |
| InChI | InChI=1S/C17H17NO3/c19-15-8-6-14(12-16(15)20)7-9-17(21)18-11-10-13-4-2-1-3-5-13/h1-9,12,19-20H,10-11H2,(H,18,21)/b9-7+ |
| InChIKey | QOWABIXYAFJMQE-VQHVLOKHSA-N |
| SMILES | C1=CC=C(C=C1)CCNC(=O)/C=C/C2=CC(=C(C=C2)O)O |
