For research use only. Not for therapeutic Use.
KT172（Cat No.:I012410）is a synthetic small molecule under investigation for its potential therapeutic effects, particularly in the treatment of cancer. It acts as a potent inhibitor of certain proteins involved in tumor progression, such as those regulating cell cycle and apoptosis. KT172 has shown promise in preclinical studies, demonstrating the ability to suppress tumor growth and induce cell death in various cancer types. Its mechanism of action primarily targets specific pathways involved in cancer cell survival, making it a promising candidate for further clinical development in oncology treatments.
| Catalog Number | I012410 |
| CAS Number | 1402612-56-9 |
| Synonyms | (2-benzylpiperidin-1-yl)-[4-[4-(2-methoxyphenyl)phenyl]triazol-1-yl]methanone |
| Molecular Formula | C28H28N4O2 |
| Purity | ≥95% |
| IUPAC Name | (2-benzylpiperidin-1-yl)-[4-[4-(2-methoxyphenyl)phenyl]triazol-1-yl]methanone |
| InChI | InChI=1S/C28H28N4O2/c1-34-27-13-6-5-12-25(27)22-14-16-23(17-15-22)26-20-32(30-29-26)28(33)31-18-8-7-11-24(31)19-21-9-3-2-4-10-21/h2-6,9-10,12-17,20,24H,7-8,11,18-19H2,1H3 |
| InChIKey | MXVVJNJNDCJCFS-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C2=CC=C(C=C2)C3=CN(N=N3)C(=O)N4CCCCC4CC5=CC=CC=C5 |
