For research use only. Not for therapeutic Use.
KT203(CAT: I011630) is a potent and selective inhibitor of HDAC6 (histone deacetylase 6), an enzyme involved in regulating cellular processes such as protein degradation, cytoskeletal dynamics, and stress response. By specifically targeting HDAC6, KT203 modulates acetylation levels of α-tubulin and other non-histone proteins, making it particularly valuable in cancer and neurodegenerative disease research. This compound aids in studying the role of HDAC6 in cancer progression, protein aggregation disorders, and immune regulation. KT203 is a crucial tool for exploring therapeutic strategies targeting HDAC6 and advancing drug discovery in oncology and neurological disorders.
CAS Number | 1402612-64-9 |
Synonyms | 4/’-[1-[[2-(phenylmethyl)-1-piperidinyl]carbonyl]-1H-1,2,3-triazol-4-yl]-[1,1/’-biphenyl]-3-carboxylic acid |
Molecular Formula | C28H26N4O3 |
Purity | ≥95% |
Target | MAGL |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
IUPAC Name | 3-[4-[1-(2-benzylpiperidine-1-carbonyl)triazol-4-yl]phenyl]benzoic acid |
InChI | InChI=1S/C28H26N4O3/c33-27(34)24-10-6-9-23(18-24)21-12-14-22(15-13-21)26-19-32(30-29-26)28(35)31-16-5-4-11-25(31)17-20-7-2-1-3-8-20/h1-3,6-10,12-15,18-19,25H,4-5,11,16-17H2,(H,33,34) |
InChIKey | SSSCOJOXPDDHOO-UHFFFAOYSA-N |
SMILES | C1CCN(C(C1)CC2=CC=CC=C2)C(=O)N3C=C(N=N3)C4=CC=C(C=C4)C5=CC(=CC=C5)C(=O)O |