For research use only. Not for therapeutic Use.
KT5720 (Cat.No:I007535) is a potent and selective inhibitor of protein kinase A (PKA), a key regulator in various signaling pathways, including those involved in cell growth, differentiation, and metabolism. It specifically targets the catalytic subunit of PKA, disrupting its function. KT5720 is widely used in research to study PKA’s role in cellular processes, including cancer, cardiovascular disease, and neurobiology. Its selective inhibition helps clarify PKA’s involvement in disease mechanisms and
| Catalog Number | I007535 |
| CAS Number | 108068-98-0 |
| Synonyms | KT 5720; KT5720; KT-5720.;hexyl (15R,16R,18S)-16-hydroxy-15-methyl-3-oxo-28-oxa-4,14,19-triazaoctacyclo[12.11.2.1^{15,18}.0^{2,6}.0^{7,27}.0^{8,13}.0^{19,26}.0^{20,25}]octacosa-1(26),2(6),7(27),8,10,12,20,22,24-nonaene-16-carboxylate |
| Molecular Formula | C₃₂H₃₁N₃O₅ |
| Purity | ≥95% |
| Target | TGF-beta/Smad |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | hexyl (15R,16S,18S)-16-hydroxy-15-methyl-3-oxo-28-oxa-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1,6,8,10,12,20,22,24,26-nonaene-16-carboxylate |
| InChI | InChI=1S/C32H31N3O5/c1-3-4-5-10-15-39-30(37)32(38)16-23-34-21-13-8-6-11-18(21)25-26-20(17-33-29(26)36)24-19-12-7-9-14-22(19)35(28(24)27(25)34)31(32,2)40-23/h6-9,11-14,23,38H,3-5,10,15-17H2,1-2H3,(H,33,36) |
| InChIKey | ZHEHVZXPFVXKEY-UHFFFAOYSA-N |
| SMILES | CCCCCCOC(=O)C1(CC2N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N(C7=C53)C1(O2)C)CNC6=O)O |
