For research use only. Not for therapeutic Use.
KUN29943（Cat No.:I030194）is a selective small-molecule inhibitor targeting the enzyme 3-phosphoinositide-dependent protein kinase-1 (PDK1), which plays a key role in the PI3K/Akt signaling pathway. By inhibiting PDK1, KUN29943 disrupts cellular survival and proliferation signals, making it a promising candidate for cancer therapy, particularly in tumors with dysregulated PI3K/Akt activity. This compound has been studied for its ability to reduce tumor growth and enhance apoptosis in cancer cells. KUN29943 is valuable for researchers exploring targeted cancer therapies and the modulation of oncogenic signaling pathways.
| Catalog Number | I030194 |
| CAS Number | 425629-94-3 |
| Synonyms | KUN29943; KUN 29943; KUN-29943; PfDHODH-IN-2; |
| Molecular Formula | C13H12ClNO3S |
| Purity | 98% |
| Solubility | To be determined |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | ethyl 5-(4-chlorophenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate |
| InChI | InChI=1S/C13H12ClNO3S/c1-2-18-13(17)11-10(16)7-19-12(11)15-9-5-3-8(14)4-6-9/h3-6,16H,2,7H2,1H3 |
| InChIKey | APZUOZADGNBHOB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(CSC1=NC2=CC=C(C=C2)Cl)O |
