For research use only. Not for therapeutic Use.
Kuromanin chloride (Cat No.:I004656) is a natural phenanthridinium compound found in plants like mulberry. It exhibits a red or purple color and is commonly used as a biological stain in laboratory applications. Kuromanin chloride has been studied for its antioxidant properties and potential health benefits, including anti-inflammatory and neuroprotective effects. It has shown promise in various research areas, such as cancer therapy and cardiovascular health. As a natural pigment, it has also been used in food and cosmetic industries for its coloring properties.
| Catalog Number | I004656 |
| CAS Number | 7084-24-4 |
| Synonyms | Chrysontemin;Cyanidin 3-O-β-glucopyranoside |
| Molecular Formula | C21H21O11 • Cl |
| Purity | ≥95% |
| Target | CD38 |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromenylium-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol;chloride |
| InChI | InChI=1S/C21H20O11.ClH/c22-7-16-17(27)18(28)19(29)21(32-16)31-15-6-10-12(25)4-9(23)5-14(10)30-20(15)8-1-2-11(24)13(26)3-8;/h1-6,16-19,21-22,27-29H,7H2,(H3-,23,24,25,26);1H/t16-,17-,18+,19-,21-;/m1./s1 |
| InChIKey | YTMNONATNXDQJF-UBNZBFALSA-N |
| SMILES | C1=CC(=C(C=C1C2=[O+]C3=CC(=CC(=C3C=C2OC4C(C(C(C(O4)CO)O)O)O)O)O)O)O.[Cl-] |
| Reference | <p style=/line-height:25px/> </p> |
