For research use only. Not for therapeutic Use.
KYN-101（Cat No.:I041319）is an investigational therapeutic compound being developed for the treatment of autoimmune diseases and inflammatory disorders. It acts as an inhibitor of the kynurenine pathway, which plays a role in regulating immune responses and inflammation. By targeting specific enzymes within this pathway, KYN-101 aims to modulate immune cell activity, reducing the inflammatory processes that contribute to conditions like rheumatoid arthritis and multiple sclerosis. Preclinical studies have demonstrated its potential to restore immune balance, offering a promising therapeutic approach to chronic inflammatory diseases with fewer side effects compared to traditional treatments.
| CAS Number | 2247950-73-6 |
| Synonyms | 5-(5-fluoropyridin-3-yl)-N-[2-(1H-indol-3-yl)ethyl]-3-methylpyrazolo[1,5-a]pyrimidin-7-amine |
| Molecular Formula | C22H19FN6 |
| Purity | ≥95% |
| IUPAC Name | 5-(5-fluoropyridin-3-yl)-N-[2-(1H-indol-3-yl)ethyl]-3-methylpyrazolo[1,5-a]pyrimidin-7-amine |
| InChI | InChI=1S/C22H19FN6/c1-14-10-27-29-21(9-20(28-22(14)29)16-8-17(23)13-24-11-16)25-7-6-15-12-26-19-5-3-2-4-18(15)19/h2-5,8-13,25-26H,6-7H2,1H3 |
| InChIKey | XIBYMKUWLQLNLC-UHFFFAOYSA-N |
| SMILES | CC1=C2N=C(C=C(N2N=C1)NCCC3=CNC4=CC=CC=C43)C5=CC(=CN=C5)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
