For research use only. Not for therapeutic Use.
Kynurenic acid (Cat No.: R048054) is a metabolite of the amino acid tryptophan, produced through the kynurenine pathway. It acts as an endogenous NMDA receptor antagonist and has neuroprotective properties, playing a role in the regulation of glutamate signaling in the brain. Kynurenic acid is being studied for its potential therapeutic effects in neurological and psychiatric disorders, such as schizophrenia, depression, and neurodegenerative diseases. Altered levels of kynurenic acid have been associated with several brain disorders, making it a target for drug development.
CAS Number | 492-27-3 |
Synonyms | 4-Hydroxy-2-quinolinecarboxylic Acid; 4-Hydroxy-quinaldic Acid; 2-Carboxy-4-hydroxyquinoline; 4-Hydroxyquinaldic Acid; 4-Hydroxyquinaldinic Acid; Quinurenic Acid; NSC 58973; |
Molecular Formula | C10H7NO3 |
Purity | ≥95% |
Target | Neuronal Signaling |
Solubility | Soluble in DMSO > 10 mM |
Storage | Store at RT |
IUPAC Name | 4-oxo-1H-quinoline-2-carboxylic acid |
InChI | InChI=1S/C10H7NO3/c12-9-5-8(10(13)14)11-7-4-2-1-3-6(7)9/h1-5H,(H,11,12)(H,13,14) |
InChIKey | HCZHHEIFKROPDY-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=O)C=C(N2)C(=O)O |