For research use only. Not for therapeutic Use.
KYP-2047(Cat No.:I007545)is a selective small molecule inhibitor that targets the protein 5-lipoxygenase-activating protein (FLAP), which plays a critical role in the production of leukotrienes, inflammatory mediators involved in allergic responses and inflammatory diseases. By inhibiting FLAP, KYP-2047 helps reduce leukotriene synthesis, offering potential therapeutic benefits for conditions such as asthma, rheumatoid arthritis, and other inflammatory disorders. This compound has shown promise in preclinical studies for its ability to modulate immune responses and inflammation, making it a valuable tool in the development of targeted therapies for chronic inflammatory conditions.
CAS Number | 796874-99-2 |
Synonyms | (2S)-1-[(2S)-1-(4-phenylbutanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carbonitrile |
Molecular Formula | C20H25N3O2 |
Purity | ≥95% |
IUPAC Name | (2S)-1-[(2S)-1-(4-phenylbutanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carbonitrile |
InChI | InChI=1S/C20H25N3O2/c21-15-17-10-5-13-22(17)20(25)18-11-6-14-23(18)19(24)12-4-9-16-7-2-1-3-8-16/h1-3,7-8,17-18H,4-6,9-14H2/t17-,18-/m0/s1 |
InChIKey | SPXFAUXQZWJGCJ-ROUUACIJSA-N |
SMILES | C1C[C@H](N(C1)C(=O)[C@@H]2CCCN2C(=O)CCCC3=CC=CC=C3)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |