For research use only. Not for therapeutic Use.
L-012 sodium salt is a chemiluminescent probe widely used in biochemical research to detect reactive oxygen species (ROS), such as superoxide anions and peroxynitrite. It emits light upon reacting with these reactive species, making it a valuable tool for studying oxidative stress in biological systems. L-012 sodium salt is particularly useful in experiments involving inflammation, cardiovascular diseases, and neurodegenerative disorders, where ROS play a critical role. Its high sensitivity allows for real-time monitoring of ROS production in various in vitro and in vivo models.
| Catalog Number | I010685 |
| CAS Number | 143556-24-5 |
| Synonyms | sodium;8-amino-5-chloro-1-oxo-7-phenyl-2H-pyrido[3,4-d]pyridazin-4-olate |
| Molecular Formula | C13H8ClN4NaO2 |
| Purity | ≥95% |
| InChI | InChI=1S/C13H9ClN4O2.Na/c14-11-8-7(12(19)17-18-13(8)20)9(15)10(16-11)6-4-2-1-3-5-6;/h1-5H,15H2,(H,17,19)(H,18,20);/q;+1/p-1 |
| InChIKey | IGEUYSJHQQCEFP-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C2=C(C3=C(C(=NNC3=O)[O-])C(=N2)Cl)N.[Na+] |
