For research use only. Not for therapeutic Use.
L-163,101 is a selective antagonist of the oxytocin receptor, used primarily in reproductive and neuroendocrine research. By blocking the oxytocin receptor, L-163,101 inhibits the effects of oxytocin, a hormone involved in childbirth, lactation, and social bonding. This compound is widely utilized to study the role of oxytocin in various physiological and behavioral processes, including uterine contractions, emotional regulation, and stress responses. Its specificity for the oxytocin receptor makes L-163,101 a valuable tool in exploring therapeutic approaches for conditions such as preterm labor, anxiety, and certain social or mood disorders.
| Catalog Number | I007550 |
| CAS Number | 162112-43-8 |
| Synonyms | L-163,101; L 163,101; L163,101.;N-[2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-4-(2-methylpropyl)phenyl]sulfonylbenzamide |
| Molecular Formula | C23H26F2N6O |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4°C for short term , or -20°C for long term. |
| InChI | InChI=1S/C23H26F2N6O/c24-23(25)4-8-31(15-23)22-11-18(17-2-6-30(7-3-17)19-13-32-14-19)10-21(29-22)28-20-9-16(12-26)1-5-27-20/h1,5,9-11,17,19H,2-4,6-8,13-15H2,(H,27,28,29) |
| InChIKey | RHFIAUKMKYHHFA-UHFFFAOYSA-N |
| SMILES | N#CC1=CC=NC(NC2=NC(N3CC(F)(F)CC3)=CC(C4CCN(C5COC5)CC4)=C2)=C1 |
