For research use only. Not for therapeutic Use.
L-2-Aminobutanol-d5 is a deuterated derivative of L-2-aminobutanol, where five hydrogen atoms are replaced with deuterium. This compound is used in research, particularly in studying biochemical pathways, as the deuterium atoms allow for easier tracking of the molecule using spectroscopic methods. L-2-Aminobutanol itself is a chiral amino alcohol, which serves as a building block in the synthesis of various pharmaceuticals and fine chemicals, including beta-blockers and other active pharmaceutical ingredients.
| CAS Number | 1217783-40-8 |
| Synonyms | (2S)-2-Amino-1-butanol-d5; (+)-2-Amino-1-butanol-d5; (2S)-2-Aminobutan-1-ol-d5; ?(S)-2-Aminobutanol-d5; L-(+)-2-Aminobutanol-d5; d-2-Amino-1-butanol-d5; |
| Molecular Formula | C4H11NO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (2S)-2-amino-3,3,4,4,4-pentadeuteriobutan-1-ol |
| InChI | InChI=1S/C4H11NO/c1-2-4(5)3-6/h4,6H,2-3,5H2,1H3/t4-/m0/s1/i1D3,2D2 |
| InChIKey | JCBPETKZIGVZRE-JWUQSEDQSA-N |
| SMILES | CCC(CO)N |
