For research use only. Not for therapeutic Use.
L-4-Acetylphenylalanine is a modified amino acid derived from phenylalanine, featuring an acetyl group at the para position of the aromatic ring. This compound is utilized in biochemical research and protein engineering. Its unique structure allows for the study of protein interactions and the development of novel therapeutics, making it valuable in advancing medical and biochemical sciences.
CAS Number | 122555-04-8 |
Molecular Formula | C11H13NO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2S)-3-(4-acetylphenyl)-2-aminopropanoic acid |
InChI | InChI=1S/C11H13NO3/c1-7(13)9-4-2-8(3-5-9)6-10(12)11(14)15/h2-5,10H,6,12H2,1H3,(H,14,15)/t10-/m0/s1 |
InChIKey | ZXSBHXZKWRIEIA-JTQLQIEISA-N |
SMILES | CC(=O)C1=CC=C(C=C1)CC(C(=O)O)N |