For research use only. Not for therapeutic Use.
L 642946 is a bioactive chemical.
| Catalog Number | I030282 |
| CAS Number | 80730-81-0 |
| Synonyms | L 642946; L-642946; L642946; |
| Molecular Formula | C24H20N5NaO5S4 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | sodium (6R,7R)-7-((1-benzylpyridin-1-ium-4-yl)amino)-3-(((5-((carboxylatomethyl)thio)-1,3,4-thiadiazol-2-yl)thio)methyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| InChI | InChI=1S/C24H21N5O5S4.Na/c30-17(31)13-37-24-27-26-23(38-24)36-12-15-11-35-21-18(20(32)29(21)19(15)22(33)34)25-16-6-8-28(9-7-16)10-14-4-2-1-3-5-14;/h1-9,18,21H,10-13H2,(H2,30,31,33,34);/q;+1/p-1/t18-,21-;/m1./s1 |
| InChIKey | MYJKOJOAXNZQEL-IUFJOMBNSA-M |
| SMILES | O=C1[C@@H](NC2=CC=[N+](CC3=CC=CC=C3)C=C2)[C@@]4([H])SCC(CSC5=NN=C(SCC([O-])=O)S5)=C(C([O-])=O)N14.[Na+] |
| Reference | 1: Pelak BA, Gilfillan EC, Weissberger B, Gadebusch HH. Quaternary heterocyclylamino beta-lactams. VI. In vitro and in vivo antibacterial properties of L-642,946 and L-652,813, a long acting cephem. J Antibiot (Tokyo). 1987 Mar;40(3):354-62. PubMed PMID: 3570988. |
