L-685,458（Cat No.:I003019） is a compound that acts as a highly specific and potent inhibitor of beta PP gamma-secretase activity. It has a Ki value of 17 nM, meaning that it can bind tightly to and effectively block the activity of this enzyme, which is involved in the production of amyloid beta peptides in Alzheimer’s disease. By inhibiting beta PP gamma-secretase activity, L-685,458 can potentially reduce the accumulation of these peptides in the brain and delay the progression of Alzheimer’s disease.
| Catalog Number | I003019 |
| CAS Number | 292632-98-5 |
| Synonyms | tert-butyl N-[(2S,3R,5R)-6-[[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-5-benzyl-3-hydroxy-6-oxo-1-phenylhexan-2-yl]carbamate |
| Molecular Formula | C₃₉H₅₂N₄O₆ |
| Purity | ≥95% |
| Target | Gamma Secretase |
| Solubility | DMSO: ≥ 31 mg/mL |
| Storage | Store at -20°C |
| IC50 | 17 nM |
| IUPAC Name | tert-butyl N-[(2S,3R,5R)-6-[[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-5-benzyl-3-hydroxy-6-oxo-1-phenylhexan-2-yl]carbamate |
| InChI | InChI=1S/C39H52N4O6/c1-26(2)21-33(37(47)41-32(35(40)45)24-29-19-13-8-14-20-29)42-36(46)30(22-27-15-9-6-10-16-27)25-34(44)31(23-28-17-11-7-12-18-28)43-38(48)49-39(3,4)5/h6-20,26,30-34,44H,21-25H2,1-5H3,(H2,40,45)(H,41,47)(H,42,46)(H,43,48)/t30-,31-,32-,33- |
| InChIKey | MURCDOXDAHPNRQ-PJRHAEEISA-N |
| SMILES | CC(C)CC(C(=O)NC(CC1=CC=CC=C1)C(=O)N)NC(=O)C(CC2=CC=CC=C2)CC(C(CC3=CC=CC=C3)NC(=O)OC(C)(C)C)O |
| Reference | <p style=/line-height:25px/> |
