For research use only. Not for therapeutic Use.
L-779450(Cat No.:I003063)is a potent and selective inhibitor of farnesyltransferase, an enzyme involved in the post-translational modification of proteins such as Ras, which plays a critical role in cell signaling pathways related to cancer. By inhibiting farnesyltransferase, L-779450 prevents the proper localization and function of Ras proteins, thereby disrupting cancer cell growth and survival. It has been studied in preclinical models for its potential in targeting Ras-driven tumors, including pancreatic and lung cancers. L-779450 is a valuable tool in cancer research, particularly for exploring therapeutic interventions against Ras-dependent malignancies.
CAS Number | 303727-31-3 |
Synonyms | 2-chloro-5-(2-phenyl-5-(pyridin-4-yl)-1H-imidazol-4-yl)phenol |
Molecular Formula | C₂₀H₁₄ClN₃O |
Purity | ≥95% |
Target | Autophagy |
Solubility | 100 mM in DMSO |
Storage | 2-8°C |
IUPAC Name | 2-chloro-5-(2-phenyl-5-pyridin-4-yl-1H-imidazol-4-yl)phenol |
InChI | InChI=1S/C20H14ClN3O/c21-16-7-6-15(12-17(16)25)19-18(13-8-10-22-11-9-13)23-20(24-19)14-4-2-1-3-5-14/h1-12,25H,(H,23,24) |
InChIKey | WXJLXRNWMLWVFB-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=NC(=C(N2)C3=CC=NC=C3)C4=CC(=C(C=C4)Cl)O |
Reference | <p style=/line-height:25px/> |