For research use only. Not for therapeutic Use.
L 888607 is a potent and selective antagonist of the neurokinin-1 (NK1) receptor, which plays a key role in pain perception, inflammation, and the stress response. By blocking the NK1 receptor, L 888607 inhibits the binding of substance P, a neuropeptide involved in mediating pain and stress-related pathways. This compound is primarily used in research to explore the role of NK1 receptors in pain management, anxiety, and depression. Its selectivity makes it a valuable tool for developing new therapeutic strategies for pain and psychiatric disorders.
| Catalog Number | I007324 |
| CAS Number | 860033-06-3 |
| Synonyms | 2-[(3S)-4-(4-chlorophenyl)sulfanyl-7-fluoro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl]acetic acid |
| Molecular Formula | C19H15ClFNO2S |
| Purity | ≥95% |
| InChI | InChI=1S/C19H15ClFNO2S/c20-12-1-4-14(5-2-12)25-19-15-6-3-13(21)10-16(15)22-8-7-11(18(19)22)9-17(23)24/h1-6,10-11H,7-9H2,(H,23,24)/t11-/m0/s1 |
| InChIKey | GSBAVONRPNJJOH-NSHDSACASA-N |
| SMILES | C1CN2C3=C(C=CC(=C3)F)C(=C2C1CC(=O)O)SC4=CC=C(C=C4)Cl |
