L-Alanine-1-13C（Cat No.:S000672） is a labeled variant of L-alanine, where the alpha carbon is enriched with carbon-13. This specific isotopic labeling enhances its detectability in analytical methods such as NMR spectroscopy and mass spectrometry, making it particularly useful for studying metabolic pathways involving alanine. L-alanine is a non-essential amino acid crucial for protein synthesis and plays a significant role in glucose metabolism. The carbon-13 enrichment at the first position allows researchers to trace and analyze alanine’s incorporation into proteins and its transformations in various metabolic processes, providing valuable insights into its biological functions.
| Catalog Number | S000672 |
| CAS Number | 21764-56-7 |
| Molecular Formula | C213CH7NO2 |
| Purity | 95% |
| IUPAC Name | (2S)-2-amino(113C)propanoic acid |
| InChI | InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1/i3+1 |
| InChIKey | QNAYBMKLOCPYGJ-NSQKCYGPSA-N |
| SMILES | CC(C(=O)O)N |
