For research use only, not for therapeutic use.
is a labeled form of L-alanine, where both carbon atoms are enriched with carbon-13, enhancing its detectability in analytical techniques such as NMR spectroscopy and mass spectrometry. This dual labeling is particularly valuable for studying alanine’s metabolic pathways and its role in protein synthesis and glucose metabolism. L-alanine is a non-essential amino acid that is fundamental to numerous biological processes. The enrichment with carbon-13 at both carbon positions allows researchers to trace and analyze how alanine is integrated into proteins and utilized in metabolic functions, offering detailed insights into its biochemical activity.
| Catalog Number | S000674 |
| CAS Number | 65163-26-0 |
| Molecular Formula | C13C2H7NO2 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-amino(2,3-13C2)propanoic acid |
| InChI | InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1/i1+1,2+1 |
| InChIKey | QNAYBMKLOCPYGJ-GSPFBODJSA-N |
| SMILES | CC(C(=O)O)N |
