L-Alanine-13C2,15N（Cat No.:S000675） is a triply labeled variant of L-alanine, where both carbon atoms are enriched with carbon-13 and the nitrogen atom is enriched with nitrogen-15. This comprehensive isotopic labeling significantly enhances its detectability for precise analytical methods such as NMR spectroscopy and mass spectrometry. This form of L-Alanine is invaluable for detailed studies of protein synthesis, nitrogen metabolism, and amino acid catabolism. The specific labeling allows researchers to trace and analyze alanine’s role in cellular processes more accurately, providing deeper insights into its metabolic pathways and interactions within biological systems.
| Catalog Number | S000675 |
| CAS Number | 312623-85-1 |
| Molecular Formula | C13C2H715NO2 |
| Purity | 95% |
| IUPAC Name | (2S)-2-(15N)azanyl(1,2,3-13C3)propanoic acid |
| InChI | InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1/i1+1,2+1,3+1,4+1 |
| InChIKey | QNAYBMKLOCPYGJ-UVYXLFMMSA-N |
| SMILES | CC(C(=O)O)N |
