For research use only. Not for therapeutic Use.
L-Alanine-¹³C₃ is a carbon-13 labeled version of L-alanine, a non-essential amino acid involved in protein synthesis and metabolism. The three carbon-13 isotopes replace hydrogen atoms, making it useful for metabolic studies and tracking biochemical pathways. This labeled amino acid helps researchers investigate protein dynamics, amino acid metabolism, and enzymatic reactions through techniques like NMR spectroscopy and mass spectrometry. Its applications are significant in biochemical research, organic chemistry, and nutritional studies, providing insights into metabolic processes and the synthesis of proteins and other biomolecules.
| CAS Number | 100108-77-8 |
| Synonyms | L-Alanine-1,2,3-13C3 |
| Molecular Formula | C3H7NO2 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | -20°C |
| IUPAC Name | (2S)-2-aminopropanoic acid |
| InChI | InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1/i1+1,2+1,3+1 |
| InChIKey | QNAYBMKLOCPYGJ-GCCOVPGMSA-N |
| SMILES | [13CH3][13C@@H]([13C](=O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |