For research use only. Not for therapeutic Use.
L-Alanine-13C,d(Cat No.:S000673) is a labeled form of L-alanine, where the alpha carbon is enriched with carbon-13 and one or more hydrogen atoms are replaced with deuterium. This dual labeling significantly enhances its molecular stability and detectability for advanced analytical methods like NMR spectroscopy and mass spectrometry. L-alanine is an important amino acid involved in protein synthesis and glucose metabolism. The incorporation of carbon-13 and deuterium allows for precise studies of alanine’s metabolic pathways and interactions within biological systems, providing deeper insights into its role in cellular processes and energy metabolism.
CAS Number | 160033-81-8 |
Molecular Formula | C213CH6DNO2 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | (2S)-2-amino-2-deuterio(313C)propanoic acid |
InChI | InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1/i1+1,2D |
InChIKey | QNAYBMKLOCPYGJ-LFEAEDJLSA-N |
SMILES | CC(C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |