For research use only. Not for therapeutic Use.
L-Alanine-15N（Cat No.:S000676） is a labeled form of L-alanine where the nitrogen atom is enriched with nitrogen-15, enhancing its detectability in sophisticated analytical methods such as NMR spectroscopy and mass spectrometry. This isotopic enrichment is particularly valuable for studying nitrogen metabolism and protein synthesis involving alanine. L-Alanine is a non-essential amino acid important for glucose metabolism and energy production in muscles. The labeling allows researchers to precisely track and analyze alanine’s incorporation into proteins and its role in various metabolic pathways, providing deeper insights into its biological functions and interactions.
| Catalog Number | S000676 |
| CAS Number | 25713-23-9 |
| Molecular Formula | C3H715NO2 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-(15N)azanylpropanoic acid |
| InChI | InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1/i4+1 |
| InChIKey | QNAYBMKLOCPYGJ-GZPBOPPUSA-N |
| SMILES | CC(C(=O)O)N |
