For research use only. Not for therapeutic Use.
L-Alanine-d3 is a deuterated form of the amino acid L-Alanine, essential for advanced research in biochemistry and pharmaceuticals. This isotopically labeled compound is vital for studying amino acid metabolism, protein synthesis, and metabolic pathways. Its stable isotope labeling ensures precise and accurate mass spectrometry and NMR analysis, providing reliable data in complex biological systems. Ideal for research on metabolic disorders, enzyme activities, and nutritional studies, L-Alanine-d3 enhances the understanding of amino acid functions and their impact on health.
Catalog Number | R026781 |
CAS Number | 63546-27-0 |
Synonyms | L-[3,3,3-d3]Alanine; β,β,β-Trideutero-L-alanine; L-Alanine-3,3,3-d3 |
Molecular Formula | C3H7NO2 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | (2S)-2-amino-3,3,3-trideuteriopropanoic acid |
InChI | InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1/i1D3 |
InChIKey | QNAYBMKLOCPYGJ-VGCLAIIRSA-N |
SMILES | CC(C(=O)O)N |