For research use only. Not for therapeutic Use.
L-Alanine-d4(Cat No.:S000574) is a specialized form of alanine, a non-essential amino acid crucial for protein synthesis and various metabolic processes. The “d4” designation indicates that four hydrogen atoms in the alanine molecule are replaced with deuterium, a stable isotope of hydrogen. This isotopic labeling enables precise tracking of alanine metabolism and its incorporation into proteins and other biomolecules using advanced analytical techniques like mass spectrometry and nuclear magnetic resonance spectroscopy.
Catalog Number | S000574 |
CAS Number | 18806-29-6 |
Molecular Formula | C3H3D4NO2 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | (2S)-2-amino-2,3,3,3-tetradeuteriopropanoic acid |
InChI | InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1/i1D3,2D |
InChIKey | QNAYBMKLOCPYGJ-IALWIIEESA-N |
SMILES | CC(C(=O)O)N |