For research use only. Not for therapeutic Use.
L-Ascorbic acid-13C-2（Cat No.:I043083）is a stable isotope-labeled form of L-ascorbic acid (vitamin C), where two carbon atoms are replaced with the isotope carbon-13 (13C). This modified form is commonly used in scientific research, particularly in studies involving metabolic pathways, bioavailability, and the role of vitamin C in human health. The incorporation of 13C allows for precise tracking of the compound’s movement and metabolism in biological systems using techniques like nuclear magnetic resonance (NMR) or mass spectrometry. L-Ascorbic acid-13C-2 is valuable for studying vitamin C’s impact on oxidative stress, immune function, and other physiological processes.
| CAS Number | 1313730-17-4 |
| Synonyms | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-(313C)2H-furan-5-one |
| Molecular Formula | C513CH8O6 |
| Purity | ≥95% |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-(313C)2H-furan-5-one |
| InChI | InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1/i3+1 |
| InChIKey | CIWBSHSKHKDKBQ-VZMNSLOISA-N |
| SMILES | C([C@@H]([C@@H]1[13C](=C(C(=O)O1)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
