For research use only. Not for therapeutic Use.
L-Ascorbic acid-13C(Cat No.:S000565) is a specialized form of ascorbic acid, commonly known as vitamin C, crucial for various physiological functions including antioxidant defense, collagen synthesis, and immune system support. The “13C” designation indicates that one or more carbon atoms in the ascorbic acid molecule are replaced with the stable carbon isotope carbon-13. This isotopic labeling facilitates precise tracking of ascorbic acid metabolism and its incorporation into cellular pathways using advanced analytical techniques like mass spectrometry. L-Ascorbic acid-13C serves as a valuable tool in metabolic studies, aiding in elucidating pathways, understanding cellular physiology, and investigating diseases related to vitamin C metabolism.
CAS Number | 178101-88-7 |
Molecular Formula | C513CH8O6 |
Purity | ≥95% |
Target | Immunology/Inflammation |
IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-(513C)2H-furan-5-one |
InChI | InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1/i6+1 |
InChIKey | CIWBSHSKHKDKBQ-HYAXHRHPSA-N |
SMILES | C(C(C1C(=C(C(=O)O1)O)O)O)O |