For research use only. Not for therapeutic Use.
L-Aspartic Acid 4-tert-Butyl Ester(Cat No.:R061577), is a chemical compound used in organic synthesis and pharmaceutical research. It is a derivative of the amino acid aspartic acid, where the amino group has been protected with a tert-butyl ester group. This protective group temporarily blocks the reactivity of the amino group, allowing for controlled reactions and the introduction of other chemical groups. L-aspartic acid 4-tert-butyl Ester is employed as a key intermediate in the synthesis of peptides and pharmaceutical compounds, enabling researchers to create specific molecular structures and investigate potential drug candidates.
CAS Number | 3057-74-7 |
Synonyms | L-Aspartic Acid 4-(1,1-Dimethylethyl) Ester; (S)-2-Amino-4-tert-butoxy-4-oxobutanoic Acid; Aspartic Acid β-tert-Butyl Ester; L-Aspartic Acid β-tert-Butyl Ester; β-tert-Butyl L-Aspartate; β-tert-Butyl Aspartate |
Molecular Formula | C8H15NO4 |
Purity | ≥95% |
Storage | Room temperature |
IUPAC Name | (2S)-2-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
InChI | InChI=1S/C8H15NO4/c1-8(2,3)13-6(10)4-5(9)7(11)12/h5H,4,9H2,1-3H3,(H,11,12)/t5-/m0/s1 |
InChIKey | MXWMFBYWXMXRPD-YFKPBYRVSA-N |
SMILES | CC(C)(C)OC(=O)CC(C(=O)O)N |